CAS 873415-10-2 is the registry number for 1-(2,4,6-tribromophenyl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,4,6-tribromophenyl)ethanol (CAS 873415-10-2) is a chemical compound with the molecular formula C8H7Br3O and a molecular weight of 358.85 g/mol. IUPAC name: 1-(2,4,6-tribromophenyl)ethanol. InChIKey: UJOOBNQAKOMSCY-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3O |
|---|---|
| Molecular weight | 358.85 g/mol |
| IUPAC name | 1-(2,4,6-tribromophenyl)ethanol |
| InChIKey | UJOOBNQAKOMSCY-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1Br)Br)Br)O |
Computed by PubChem (NCBI)