Products 125714-92-3
CAS 125714-92-3 is the registry number for 1,5-Dibromo-2-(bromomethyl)-4-methoxybenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
1,5-dibromo-2-(bromomethyl)-4-methoxybenzene (CAS 125714-92-3) is a chemical compound with the molecular formula C8H7Br3O and a molecular weight of 358.85 g/mol. IUPAC name: 1,5-dibromo-2-(bromomethyl)-4-methoxybenzene. InChIKey: VIARZERTVLGFLY-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3O |
|---|---|
| Molecular weight | 358.85 g/mol |
| IUPAC name | 1,5-dibromo-2-(bromomethyl)-4-methoxybenzene |
| InChIKey | VIARZERTVLGFLY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CBr)Br)Br |
Computed by PubChem (NCBI)