cas: 206347-32-2 — see every product listed under this CAS number, including other names
1,3-Dibromo-2-(2-bromoethoxy)benzene (CAS 206347-32-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F771806-1G |
| cas | 206347-32-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2663.66 Pln | |
| Fluorochem | 5g | 7854.54 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-dibromo-2-(2-bromoethoxy)benzene (CAS 206347-32-2) is a chemical compound with the molecular formula C8H7Br3O and a molecular weight of 358.85 g/mol. IUPAC name: 1,3-dibromo-2-(2-bromoethoxy)benzene. InChIKey: GGANKCYHHSNNJR-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3O |
|---|---|
| Molecular weight | 358.85 g/mol |
| IUPAC name | 1,3-dibromo-2-(2-bromoethoxy)benzene |
| InChIKey | GGANKCYHHSNNJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OCCBr)Br |
Computed by PubChem (NCBI)