CAS 20098-47-9 appears in our catalog under these names: 1,3-dibromo-2-chloro-5-nitrobenzene, 98%, 98%, 1,3-Dibromo-2-chloro-5-nitrobenzene, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
1,3-dibromo-2-chloro-5-nitrobenzene (CAS 20098-47-9) is a chemical compound with the molecular formula C6H2Br2ClNO2 and a molecular weight of 315.34 g/mol. IUPAC name: 1,3-dibromo-2-chloro-5-nitrobenzene. InChIKey: BAHAFZIGAXKLGK-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2ClNO2 |
|---|---|
| Molecular weight | 315.34 g/mol |
| IUPAC name | 1,3-dibromo-2-chloro-5-nitrobenzene |
| InChIKey | BAHAFZIGAXKLGK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)