Products 55304-86-4

CAS 55304-86-4 appears in our catalog under these names: 2,6-Dibromo-5-chloronicotinic acid, 95%, 2,6–Dibromo–5–chloronicotinic acid, 2,6-Dibromo-5-chloronicotinic acid 95%, 2,6-Dibromo-5-chloronicotinic acid, 95%, 95%, 2,6-Dibromo-5-chloronicotinic acid, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,6-dibromo-5-chloropyridine-3-carboxylic acid (CAS 55304-86-4) is a chemical compound with the molecular formula C6H2Br2ClNO2 and a molecular weight of 315.34 g/mol. IUPAC name: 2,6-dibromo-5-chloropyridine-3-carboxylic acid. InChIKey: UZLWUHWZLKEKLW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Br2ClNO2
Molecular weight315.34 g/mol
IUPAC name2,6-dibromo-5-chloropyridine-3-carboxylic acid
InChIKeyUZLWUHWZLKEKLW-UHFFFAOYSA-N
SMILESC1=C(C(=NC(=C1Cl)Br)Br)C(=O)O

Computed by PubChem (NCBI)