CAS 1855836-48-4 appears in our catalog under these names: 1,4-dibromo-2-chloro-5-nitrobenzene, 95%, 1,4-Dibromo-2-chloro-5-nitrobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1,4-dibromo-2-chloro-5-nitrobenzene (CAS 1855836-48-4) is a chemical compound with the molecular formula C6H2Br2ClNO2 and a molecular weight of 315.34 g/mol. IUPAC name: 1,4-dibromo-2-chloro-5-nitrobenzene. InChIKey: SANAAYIBGNVNRO-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2ClNO2 |
|---|---|
| Molecular weight | 315.34 g/mol |
| IUPAC name | 1,4-dibromo-2-chloro-5-nitrobenzene |
| InChIKey | SANAAYIBGNVNRO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)