cas: 1000578-25-5 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-(tert-butyl)-2-chlorobenzene 97% (CAS 1000578-25-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A496090-1g |
| cas | 1000578-25-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 25g | 1132.44 Pln | |
| Ambeed | 100g | 3941.50 Pln | |
| Ambeed | 500g | 15550.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A496090 |
1,3-dibromo-5-tert-butyl-2-chlorobenzene (CAS 1000578-25-5) is a chemical compound with the molecular formula C10H11Br2Cl and a molecular weight of 326.45 g/mol. IUPAC name: 1,3-dibromo-5-tert-butyl-2-chlorobenzene. InChIKey: WMMPUKCLMBOGTC-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2Cl |
|---|---|
| Molecular weight | 326.45 g/mol |
| IUPAC name | 1,3-dibromo-5-tert-butyl-2-chlorobenzene |
| InChIKey | WMMPUKCLMBOGTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)Cl)Br |
Computed by PubChem (NCBI)