cas: 1000578-25-5 — see every product listed under this CAS number, including other names
1,3-dibromo-5-(tert-butyl)-2-chlorobenzene, 98%, 98% (CAS 1000578-25-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FCHX-10g |
| cas | 1000578-25-5 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 266.00 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1302.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-5-tert-butyl-2-chlorobenzene (CAS 1000578-25-5) is a chemical compound with the molecular formula C10H11Br2Cl and a molecular weight of 326.45 g/mol. IUPAC name: 1,3-dibromo-5-tert-butyl-2-chlorobenzene. InChIKey: WMMPUKCLMBOGTC-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2Cl |
|---|---|
| Molecular weight | 326.45 g/mol |
| IUPAC name | 1,3-dibromo-5-tert-butyl-2-chlorobenzene |
| InChIKey | WMMPUKCLMBOGTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)Cl)Br |
Computed by PubChem (NCBI)