cas: 207226-31-1 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-(trifluoromethoxy)benzene, 95%, 95% (CAS 207226-31-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IW8-1g |
| cas | 207226-31-1 |
| size | 1g |
| availability | 55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 50g | 136.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-5-(trifluoromethoxy)benzene (CAS 207226-31-1) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 1,3-dibromo-5-(trifluoromethoxy)benzene. InChIKey: UKHOUWWEEAOCTI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 1,3-dibromo-5-(trifluoromethoxy)benzene |
| InChIKey | UKHOUWWEEAOCTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)OC(F)(F)F |
Computed by PubChem (NCBI)