cas: 72315-45-8 — see every product listed under this CAS number, including other names
1,3-Dibromoimidazo[1,5-a]pyridine 97% (CAS 72315-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199106-100mg |
| cas | 72315-45-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1221.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199106 |
1,3-dibromoimidazo[1,5-a]pyridine (CAS 72315-45-8) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 1,3-dibromoimidazo[1,5-a]pyridine. InChIKey: NEVFVTGZOQKSDN-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 1,3-dibromoimidazo[1,5-a]pyridine |
| InChIKey | NEVFVTGZOQKSDN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(N2C=C1)Br)Br |
Computed by PubChem (NCBI)