CAS 50477-28-6 appears in our catalog under these names: 5,7-Dibromo-1h-indazole, 95%, 5,7–Dibromo–1H–indazole, 5,7-Dibromo-1H-indazole 95%, 5,7-Dibromo-1H-indazole, 95%+, 95%+, 5,7-DIBROMO-1H-INDAZOLE, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 100mg, 10g, 50mg.
5,7-dibromo-1H-indazole (CAS 50477-28-6) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 5,7-dibromo-1H-indazole. InChIKey: SBDPXXDRYPLLKE-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 5,7-dibromo-1H-indazole |
| InChIKey | SBDPXXDRYPLLKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)Br)Br |
Computed by PubChem (NCBI)