cas: 72315-45-8 — see every product listed under this CAS number, including other names
1,3-Dibromoimidazo[1,5-a]pyridine, 97%, 97% (CAS 72315-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116U0Q-100mg |
| cas | 72315-45-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 1110.80 Pln | |
| Chemat | 10g | 1926.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromoimidazo[1,5-a]pyridine (CAS 72315-45-8) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 1,3-dibromoimidazo[1,5-a]pyridine. InChIKey: NEVFVTGZOQKSDN-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 1,3-dibromoimidazo[1,5-a]pyridine |
| InChIKey | NEVFVTGZOQKSDN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(N2C=C1)Br)Br |
Computed by PubChem (NCBI)