CAS 1351668-28-4 appears in our catalog under these names: 4,5-Dibromo-1h-indazole, 95%, 4,5-Dibromo-1H-indazole 97%, 1H-Indazole, 4,5-dibromo-, 97%, 97%, 4,5-DIBROMO-1H-INDAZOLE, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4,5-dibromo-1H-indazole (CAS 1351668-28-4) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 4,5-dibromo-1H-indazole. InChIKey: BIXHHZVOQFJKSH-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 4,5-dibromo-1H-indazole |
| InChIKey | BIXHHZVOQFJKSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2)Br)Br |
Computed by PubChem (NCBI)