cas: 22482-43-5 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-(2-nitrovinyl)benzene, ≥97%, ≥97% (CAS 22482-43-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G4L-1g |
| cas | 22482-43-5 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1302.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1,3-dichloro-2-[(E)-2-nitroethenyl]benzene (CAS 22482-43-5) is a chemical compound with the molecular formula C8H5Cl2NO2 and a molecular weight of 218.03 g/mol. IUPAC name: 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene. InChIKey: VXNHQIKJDIOBEC-SNAWJCMRSA-N.
| Molecular formula | C8H5Cl2NO2 |
|---|---|
| Molecular weight | 218.03 g/mol |
| IUPAC name | 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
| InChIKey | VXNHQIKJDIOBEC-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)