CAS 37630-23-2 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-2-nitroethylene, 95%, (E)-1,2-Dichloro-4-(2-nitrovinyl)benzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,2-dichloro-4-[(E)-2-nitroethenyl]benzene (CAS 37630-23-2) is a chemical compound with the molecular formula C8H5Cl2NO2 and a molecular weight of 218.03 g/mol. IUPAC name: 1,2-dichloro-4-[(E)-2-nitroethenyl]benzene. InChIKey: XHGCFWXSHIHYFH-ONEGZZNKSA-N.
| Molecular formula | C8H5Cl2NO2 |
|---|---|
| Molecular weight | 218.03 g/mol |
| IUPAC name | 1,2-dichloro-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | XHGCFWXSHIHYFH-ONEGZZNKSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)