CAS 58584-75-1 is the registry number for (2E)-3-(2,6-Dichloropyridin-3-yl)prop-2-enoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-3-(2,6-dichloro-3-pyridinyl)prop-2-enoic acid (CAS 58584-75-1) is a chemical compound with the molecular formula C8H5Cl2NO2 and a molecular weight of 218.03 g/mol. IUPAC name: (E)-3-(2,6-dichloro-3-pyridinyl)prop-2-enoic acid. InChIKey: IHIMUJNWAXYWCK-DUXPYHPUSA-N.
| Molecular formula | C8H5Cl2NO2 |
|---|---|
| Molecular weight | 218.03 g/mol |
| IUPAC name | (E)-3-(2,6-dichloro-3-pyridinyl)prop-2-enoic acid |
| InChIKey | IHIMUJNWAXYWCK-DUXPYHPUSA-N |
| SMILES | C1=CC(=NC(=C1/C=C/C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)