cas: 97608-49-6 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-(trifluoromethoxy)benzene 98% (CAS 97608-49-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499864-250mg |
| cas | 97608-49-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3318.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A499864 |
1,3-dichloro-2-(trifluoromethoxy)benzene (CAS 97608-49-6) is a chemical compound with the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. IUPAC name: 1,3-dichloro-2-(trifluoromethoxy)benzene. InChIKey: RIVHTVHBEUJLSP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 1,3-dichloro-2-(trifluoromethoxy)benzene |
| InChIKey | RIVHTVHBEUJLSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)