cas: 97608-49-6 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-(trifluoromethoxy)benzene, 98%, 98% (CAS 97608-49-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJYT-250mg |
| cas | 97608-49-6 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 856.40 Pln | |
| Chemat | 5g | 2834.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dichloro-2-(trifluoromethoxy)benzene (CAS 97608-49-6) is a chemical compound with the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. IUPAC name: 1,3-dichloro-2-(trifluoromethoxy)benzene. InChIKey: RIVHTVHBEUJLSP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 1,3-dichloro-2-(trifluoromethoxy)benzene |
| InChIKey | RIVHTVHBEUJLSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)