cas: 286014-38-8 — see every product listed under this CAS number, including other names
1,3-Dicyclohexylimidazolium tetrafluoroborate salt 98% (CAS 286014-38-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A837582-250mg |
| cas | 286014-38-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 25g | 1872.25 Pln | |
| Ambeed | 100g | 5727.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A837582 |
1,3-dicyclohexylimidazol-1-ium tetrafluoroborate (CAS 286014-38-8) is a chemical compound with the molecular formula C15H25BF4N2 and a molecular weight of 320.18 g/mol. IUPAC name: 1,3-dicyclohexylimidazol-1-ium tetrafluoroborate. InChIKey: CQHXJIHJFMBBQA-UHFFFAOYSA-N.
| Molecular formula | C15H25BF4N2 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 1,3-dicyclohexylimidazol-1-ium tetrafluoroborate |
| InChIKey | CQHXJIHJFMBBQA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1CCC(CC1)N2C=C[N+](=C2)C3CCCCC3 |
Computed by PubChem (NCBI)