cas: 64248-60-8 — see every product listed under this CAS number, including other names
1,3-Difluoro-2-trifluoromethyl-benzene (CAS 64248-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032768-1G |
| cas | 64248-60-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 513.38 Pln | |
| Fluorochem | 25g | 1877.48 Pln | |
| Fluorochem | 100g | 4850.39 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-difluoro-2-(trifluoromethyl)benzene (CAS 64248-60-8) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1,3-difluoro-2-(trifluoromethyl)benzene. InChIKey: NKKFHDNJRMWBFS-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1,3-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | NKKFHDNJRMWBFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)F |
Computed by PubChem (NCBI)