Products 886510-29-8
CAS 886510-29-8 appears in our catalog under these names: 1-(Difluoromethyl)-2,4,5-trifluorobenzene, 95%, 1-(Difluoromethyl)-2,4,5-trifluorobenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(difluoromethyl)-2,4,5-trifluorobenzene (CAS 886510-29-8) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1-(difluoromethyl)-2,4,5-trifluorobenzene. InChIKey: QCDSGWYQEVHVOG-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1-(difluoromethyl)-2,4,5-trifluorobenzene |
| InChIKey | QCDSGWYQEVHVOG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C(F)F |
Computed by PubChem (NCBI)