CAS 1214338-85-8 is the registry number for 2-(Difluoromethyl)-1,3,5-trifluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-(difluoromethyl)-1,3,5-trifluorobenzene (CAS 1214338-85-8) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 2-(difluoromethyl)-1,3,5-trifluorobenzene. InChIKey: UTBTXMURKRFVAB-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 2-(difluoromethyl)-1,3,5-trifluorobenzene |
| InChIKey | UTBTXMURKRFVAB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)F)F)F |
Computed by PubChem (NCBI)