cas: 3748-13-8 — see every product listed under this CAS number, including other names
1,3-Diisopropenylbenzene (stabilized with TBC), >97.0%(GC) (CAS 3748-13-8) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1957-25ML |
| cas | 3748-13-8 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 252.60 Pln | |
| TCI | 500ml | 778.75 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1,3-bis(prop-1-en-2-yl)benzene (CAS 3748-13-8) is a chemical compound with the molecular formula C12H14 and a molecular weight of 158.24 g/mol. IUPAC name: 1,3-bis(prop-1-en-2-yl)benzene. InChIKey: IBVPVTPPYGGAEL-UHFFFAOYSA-N.
| Molecular formula | C12H14 |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1,3-bis(prop-1-en-2-yl)benzene |
| InChIKey | IBVPVTPPYGGAEL-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC(=CC=C1)C(=C)C |
Computed by PubChem (NCBI)