cas: 3748-13-8 — see every product listed under this CAS number, including other names
1,3-Diisopropenylbenzene, 98% (CAS 3748-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094819-100G |
| cas | 3748-13-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 310.33 Pln | |
| Fluorochem | 500g | 857.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,3-bis(prop-1-en-2-yl)benzene (CAS 3748-13-8) is a chemical compound with the molecular formula C12H14 and a molecular weight of 158.24 g/mol. IUPAC name: 1,3-bis(prop-1-en-2-yl)benzene. InChIKey: IBVPVTPPYGGAEL-UHFFFAOYSA-N.
| Molecular formula | C12H14 |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1,3-bis(prop-1-en-2-yl)benzene |
| InChIKey | IBVPVTPPYGGAEL-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC(=CC=C1)C(=C)C |
Computed by PubChem (NCBI)