CAS 1605-18-1 appears in our catalog under these names: 1,4-Diisopropenylbenzene, 95%, 1,4–Diisopropenylbenzene, 1,4-Diisopropenylbenzene, 1,4-Diisopropenylbenzene, >98.0%(GC), 1,4-Diisopropenylbenzene, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100mg, 250mg.
1,4-bis(prop-1-en-2-yl)benzene (CAS 1605-18-1) is a chemical compound with the molecular formula C12H14 and a molecular weight of 158.24 g/mol. IUPAC name: 1,4-bis(prop-1-en-2-yl)benzene. InChIKey: ZENYUPUKNXGVDY-UHFFFAOYSA-N.
| Molecular formula | C12H14 |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1,4-bis(prop-1-en-2-yl)benzene |
| InChIKey | ZENYUPUKNXGVDY-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C(=C)C |
Computed by PubChem (NCBI)