cas: 1046832-21-6 — see every product listed under this CAS number, including other names
1,3-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole 97% (CAS 1046832-21-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A390521-250mg |
| cas | 1046832-21-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 448.25 Pln | |
| Ambeed | 100g | 1299.31 Pln | |
| Ambeed | 500g | 4992.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A390521 |
1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1046832-21-6) is a chemical compound with the molecular formula C11H19BN2O2 and a molecular weight of 222.09 g/mol. IUPAC name: 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: FBNAMBTYMSWTIB-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O2 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | FBNAMBTYMSWTIB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C)C |
Computed by PubChem (NCBI)