cas: 1046832-21-6 — see every product listed under this CAS number, including other names
1,3-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 1046832-21-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DKI-50g |
| cas | 1046832-21-6 |
| size | 50g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 587.60 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 100g | 1043.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1046832-21-6) is a chemical compound with the molecular formula C11H19BN2O2 and a molecular weight of 222.09 g/mol. IUPAC name: 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: FBNAMBTYMSWTIB-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O2 |
|---|---|
| Molecular weight | 222.09 g/mol |
| IUPAC name | 1,3-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | FBNAMBTYMSWTIB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C)C |
Computed by PubChem (NCBI)