cas: 21487-45-6 — see every product listed under this CAS number, including other names
1,3-Diphenyl-1H-pyrazole-4-carbaldehyde 97% (CAS 21487-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A666832-1g |
| cas | 21487-45-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 1799.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A666832 |
1,3-diphenylpyrazole-4-carbaldehyde (CAS 21487-45-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 1,3-diphenylpyrazole-4-carbaldehyde. InChIKey: LZGBMIZREYTWRI-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-4-carbaldehyde |
| InChIKey | LZGBMIZREYTWRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)