cas: 21487-45-6 — see every product listed under this CAS number, including other names
1,3-Diphenyl-1H-pyrazole-4-carbaldehyde, >98.0%(GC) (CAS 21487-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D6398-1G |
| cas | 21487-45-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 241.28 Pln | |
| TCI | 5g | 782.17 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,3-diphenylpyrazole-4-carbaldehyde (CAS 21487-45-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 1,3-diphenylpyrazole-4-carbaldehyde. InChIKey: LZGBMIZREYTWRI-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-4-carbaldehyde |
| InChIKey | LZGBMIZREYTWRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)