1,3-Diphenyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, 97%
cas: 35221-12-6 — see every product listed under this CAS number, including other names
1,3-Diphenyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, 97% (CAS 35221-12-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A515236-100mg |
| cas | 35221-12-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1054.56 Pln | |
| Ambeed | 5g | 3518.75 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 2531.60 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1036.33 Pln | |
| BLDpharm | 5g | 3452.14 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 35221-12-6) is a chemical compound with the molecular formula C16H12N2O2S and a molecular weight of 296.3 g/mol. IUPAC name: 1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: ZFIMUSUHAOSEIE-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2S |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | ZFIMUSUHAOSEIE-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
1,3-Diphenyl-2-thiobarbituric acid, DPTBA, 4,6(1H,5H)-Pyrimidinedione, dihydro-1,3-diphenyl-2-thioxo-, 1,3-diphenyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, 1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione, 1,3-Diphenyl-2-thioxo-hexahydropyrimidine-4,6-dione, 4,6(1H,5H)-Pyrimidinedione,dihydro-1,3-diphenyl-2-thioxo-, 1,3-diphenylthiobarbituric acid, ChemDiv1_027797, Oprea1_123484