CAS 730971-67-2 is the registry number for 2-((1,3-Dioxoisoindolin-2-yl)methyl)benzothioamide, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
2-[(1,3-dioxoisoindol-2-yl)methyl]benzenecarbothioamide (CAS 730971-67-2) is a chemical compound with the molecular formula C16H12N2O2S and a molecular weight of 296.3 g/mol. IUPAC name: 2-[(1,3-dioxoisoindol-2-yl)methyl]benzenecarbothioamide. InChIKey: LSEXVIPCHAGILV-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2S |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 2-[(1,3-dioxoisoindol-2-yl)methyl]benzenecarbothioamide |
| InChIKey | LSEXVIPCHAGILV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C(=O)C3=CC=CC=C3C2=O)C(=S)N |
Computed by PubChem (NCBI)