Products 2170450-99-2
CAS 2170450-99-2 is the registry number for 4-Methyl-1-(phenylsulfonyl)-1H-indole-2-carbonitrile, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(benzenesulfonyl)-4-methylindole-2-carbonitrile (CAS 2170450-99-2) is a chemical compound with the molecular formula C16H12N2O2S and a molecular weight of 296.3 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-methylindole-2-carbonitrile. InChIKey: MTEVYQUWXHEONL-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2S |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-methylindole-2-carbonitrile |
| InChIKey | MTEVYQUWXHEONL-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(N(C2=CC=C1)S(=O)(=O)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)