cas: 1788-31-4 — see every product listed under this CAS number, including other names
1,3-Diphenylpropan-2-one oxime (CAS 1788-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F750395-1G |
| cas | 1788-31-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 1502.61 Pln |
| delivery time | 3-4 weeks |
|---|
N-(1,3-diphenylpropan-2-ylidene)hydroxylamine (CAS 1788-31-4) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: N-(1,3-diphenylpropan-2-ylidene)hydroxylamine. InChIKey: SXEBLVKLMOIGER-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | N-(1,3-diphenylpropan-2-ylidene)hydroxylamine |
| InChIKey | SXEBLVKLMOIGER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=NO)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)