CAS 7570-37-8 appears in our catalog under these names: 4-Amino-4'-methoxystilbene, 95%, 4–Amino–4'–methoxystilbene, 4-Amino-4'-methoxystilbene, >97.0%(GC)(T), 4-(4-Methoxystyryl)aniline. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 5g, 1g, 200mg.
4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline (CAS 7570-37-8) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline. InChIKey: FUKHOQPXEPBRFC-NSCUHMNNSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline |
| InChIKey | FUKHOQPXEPBRFC-NSCUHMNNSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)