CAS 59776-91-9 appears in our catalog under these names: (4-Isopropylphenyl)(pyridin-4-yl)methanone, 95%, (4–Isopropylphenyl)(pyridin–4–yl)methanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(4-propan-2-ylphenyl)-pyridin-4-ylmethanone (CAS 59776-91-9) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: (4-propan-2-ylphenyl)-pyridin-4-ylmethanone. InChIKey: UXVREIOQIBVKSM-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | (4-propan-2-ylphenyl)-pyridin-4-ylmethanone |
| InChIKey | UXVREIOQIBVKSM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)