cas: 1469287-58-8 — see every product listed under this CAS number, including other names
1,3-Piperidinedicarboxylic acid, 4-methyl-, 1-(1,1-dimethylethyl) ester, (3R,4R)-rel-, 95%, 95% (CAS 1469287-58-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AS55-100mg |
| cas | 1469287-58-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 818.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1469287-58-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: IFPZGYNNPYYDGA-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | IFPZGYNNPYYDGA-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)