cas: 53448-53-6 — see every product listed under this CAS number, including other names
1,4-Anhydro-D-xylitol, 97%, 97% (CAS 53448-53-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DF72-10mg |
| cas | 53448-53-6 |
| size | 10mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 597.20 Pln | |
| Chemat | 25mg | 1005.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3R,4S)-2-(hydroxymethyl)oxolane-3,4-diol (CAS 53448-53-6) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,3R,4S)-2-(hydroxymethyl)oxolane-3,4-diol. InChIKey: KZVAAIRBJJYZOW-VPENINKCSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,3R,4S)-2-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | KZVAAIRBJJYZOW-VPENINKCSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](O1)CO)O)O |
Computed by PubChem (NCBI)