CAS 18555-65-2 appears in our catalog under these names: 5-Deoxy-L-ribose, 95%, 5–Deoxy–L–ribose, 5-Deoxy-L-ribose, L-Ribose, 5-deoxy-. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg, 10g, 5g, 25g, 100g.
(2S,3S,4S)-2,3,4-trihydroxypentanal (CAS 18555-65-2) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2S,3S,4S)-2,3,4-trihydroxypentanal. InChIKey: WDRISBUVHBMJEF-LMVFSUKVSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2S,3S,4S)-2,3,4-trihydroxypentanal |
| InChIKey | WDRISBUVHBMJEF-LMVFSUKVSA-N |
| SMILES | C[C@@H]([C@@H]([C@@H](C=O)O)O)O |
Computed by PubChem (NCBI)