Products 13039-56-0
CAS 13039-56-0 appears in our catalog under these names: 5-Deoxy-l-arabinose, 95%, 5-Deoxy-L-arabinose, 5-Deoxy-l-arabinose, 97%, 5–DEOXY–L–ARABINOSE, 5-Deoxy-L-arabinose, ≥95%, ≥95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 0,5g, 0,25g, 2,5g, 10mg, 50mg.
(2R,3S,4S)-2,3,4-trihydroxypentanal (CAS 13039-56-0) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,3S,4S)-2,3,4-trihydroxypentanal. InChIKey: WDRISBUVHBMJEF-YUPRTTJUSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,3S,4S)-2,3,4-trihydroxypentanal |
| InChIKey | WDRISBUVHBMJEF-YUPRTTJUSA-N |
| SMILES | C[C@@H]([C@@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)