1,4-Benzenedicarboxylic acid, 2-sulfo-, sodium salt (1:1), 97%
cas: 19089-60-2 — see every product listed under this CAS number, including other names
1,4-Benzenedicarboxylic acid, 2-sulfo-, sodium salt (1:1), 97% (CAS 19089-60-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EVY-1g |
| cas | 19089-60-2 |
| size | 1g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 434.00 Pln | |
| Chemat | 50g | 803.60 Pln | |
| Chemat | 100g | 1542.80 Pln | |
| Chemat | 250g | 3371.60 Pln | |
| Chemat | 500g | 6057.60 Pln | |
| Chemat | 1kg | 11901.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Sodium 4-carboxy-2-sulfobenzoate (CAS 19089-60-2) is a chemical compound with the molecular formula C8H5NaO7S and a molecular weight of 268.18 g/mol. IUPAC name: sodium 4-carboxy-2-sulfobenzoate. InChIKey: JARIJYUQOKFVAJ-UHFFFAOYSA-M.
| Molecular formula | C8H5NaO7S |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | sodium 4-carboxy-2-sulfobenzoate |
| InChIKey | JARIJYUQOKFVAJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1C(=O)O)S(=O)(=O)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)