Monosodium 2-sulfoterephthalate, 98%
cas: 19089-60-2 — see every product listed under this CAS number, including other names
Monosodium 2-sulfoterephthalate, 98% (CAS 19089-60-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A560615-1g |
| cas | 19089-60-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 754.19 Pln | |
| Ambeed | 100g | 2634.31 Pln | |
| Ambeed | 500g | 10338.38 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 25g | 808.63 Pln | |
| BLDpharm | 100g | 2835.69 Pln | |
| BLDpharm | 500g | 11138.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Sodium 4-carboxy-2-sulfobenzoate (CAS 19089-60-2) is a chemical compound with the molecular formula C8H5NaO7S and a molecular weight of 268.18 g/mol. IUPAC name: sodium 4-carboxy-2-sulfobenzoate. InChIKey: JARIJYUQOKFVAJ-UHFFFAOYSA-M.
| Molecular formula | C8H5NaO7S |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | sodium 4-carboxy-2-sulfobenzoate |
| InChIKey | JARIJYUQOKFVAJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1C(=O)O)S(=O)(=O)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)