cas: 433-19-2 — see every product listed under this CAS number, including other names
1,4-Bis(trifluoromethyl)benzene, 99.68% (CAS 433-19-2) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 50 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W014230-25 g |
| cas | 433-19-2 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 263.96 Pln | |
| MedChemExpress | 50 g | 319.69 Pln | |
| MedChemExpress | 100 g | 403.28 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.68% |
1,4-bis(trifluoromethyl)benzene (CAS 433-19-2) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 214.11 g/mol. IUPAC name: 1,4-bis(trifluoromethyl)benzene. InChIKey: PDCBZHHORLHNCZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1,4-bis(trifluoromethyl)benzene |
| InChIKey | PDCBZHHORLHNCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)