cas: 433-19-2 — see every product listed under this CAS number, including other names
1,4-Bis(trifluoromethyl)benzene (CAS 433-19-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 1g, 5g, 100g, 500g. Offered by: TRC, Fluorochem.
| brand | TRC |
|---|---|
| catalog number | TRC-F588740-25G |
| cas | 433-19-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| TRC | 25g | price on request | |
| TRC | 50g | price on request | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 221.81 Pln | |
| Fluorochem | 500g | 596.68 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1,4-bis(trifluoromethyl)benzene (CAS 433-19-2) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 214.11 g/mol. IUPAC name: 1,4-bis(trifluoromethyl)benzene. InChIKey: PDCBZHHORLHNCZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1,4-bis(trifluoromethyl)benzene |
| InChIKey | PDCBZHHORLHNCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)