cas: 175278-13-4 — see every product listed under this CAS number, including other names
1,4-Dibromo-2-(trifluoromethoxy)benzene, 95%, 95% (CAS 175278-13-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1131TI-1g |
| cas | 175278-13-4 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 472.40 Pln | |
| Chemat | 25g | 640.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,4-dibromo-2-(trifluoromethoxy)benzene (CAS 175278-13-4) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 1,4-dibromo-2-(trifluoromethoxy)benzene. InChIKey: WVMFAEDJOGXROT-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 1,4-dibromo-2-(trifluoromethoxy)benzene |
| InChIKey | WVMFAEDJOGXROT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)(F)F)Br |
Computed by PubChem (NCBI)