cas: 1605-18-1 — see every product listed under this CAS number, including other names
1,4-Diisopropenylbenzene, 98% (CAS 1605-18-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F132000-5G |
| cas | 1605-18-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 950.72 Pln | |
| Fluorochem | 10g | 1726.49 Pln | |
| Fluorochem | 25g | 3418.61 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 263.47 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,4-bis(prop-1-en-2-yl)benzene (CAS 1605-18-1) is a chemical compound with the molecular formula C12H14 and a molecular weight of 158.24 g/mol. IUPAC name: 1,4-bis(prop-1-en-2-yl)benzene. InChIKey: ZENYUPUKNXGVDY-UHFFFAOYSA-N.
| Molecular formula | C12H14 |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1,4-bis(prop-1-en-2-yl)benzene |
| InChIKey | ZENYUPUKNXGVDY-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C(=C)C |
Computed by PubChem (NCBI)