cas: 1605-18-1 — see every product listed under this CAS number, including other names
1,4-Diisopropenylbenzene, 97%, 97% (CAS 1605-18-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RYZ-100mg |
| cas | 1605-18-1 |
| size | 100mg |
| availability | 42g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 947.60 Pln | |
| Chemat | 25g | 1998.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,4-bis(prop-1-en-2-yl)benzene (CAS 1605-18-1) is a chemical compound with the molecular formula C12H14 and a molecular weight of 158.24 g/mol. IUPAC name: 1,4-bis(prop-1-en-2-yl)benzene. InChIKey: ZENYUPUKNXGVDY-UHFFFAOYSA-N.
| Molecular formula | C12H14 |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1,4-bis(prop-1-en-2-yl)benzene |
| InChIKey | ZENYUPUKNXGVDY-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C(=C)C |
Computed by PubChem (NCBI)