1,4-Diphenylnaphthalene, 98%
cas: 796-30-5 — see every product listed under this CAS number, including other names
1,4-Diphenylnaphthalene, 98% (CAS 796-30-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1920648-250mg |
| cas | 796-30-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 871.00 Pln | |
| Ambeed | 5g | 2945.81 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 1g | 1221.20 Pln | |
| Chemat | 5g | 4182.80 Pln | |
| BLDpharm | 250mg | 419.88 Pln | |
| BLDpharm | 1g | 930.81 Pln | |
| BLDpharm | 5g | 3168.91 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1,4-diphenylnaphthalene (CAS 796-30-5) is a chemical compound with the molecular formula C22H16 and a molecular weight of 280.4 g/mol. IUPAC name: 1,4-diphenylnaphthalene. InChIKey: GXLSPHDWEPSUIB-UHFFFAOYSA-N.
| Molecular formula | C22H16 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 1,4-diphenylnaphthalene |
| InChIKey | GXLSPHDWEPSUIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)