CAS 7427-84-1 is the registry number for 3,4-Dihydrodibenzo[c,g]phenanthrene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene (CAS 7427-84-1) is a chemical compound with the molecular formula C22H16 and a molecular weight of 280.4 g/mol. IUPAC name: pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene. InChIKey: AHFNMUAMYYFEGH-UHFFFAOYSA-N.
| Molecular formula | C22H16 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene |
| InChIKey | AHFNMUAMYYFEGH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C3C=C2)C4=C1C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)