Products 1233-36-9

CAS 1233-36-9 is the registry number for (E)-1,2-Di-(1-naphtyl)ethene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-[(E)-2-naphthalen-1-ylethenyl]naphthalene (CAS 1233-36-9) is a chemical compound with the molecular formula C22H16 and a molecular weight of 280.4 g/mol. IUPAC name: 1-[(E)-2-naphthalen-1-ylethenyl]naphthalene. InChIKey: REPGVFBGPZJLJD-FOCLMDBBSA-N.

Identity
Molecular formulaC22H16
Molecular weight280.4 g/mol
IUPAC name1-[(E)-2-naphthalen-1-ylethenyl]naphthalene
InChIKeyREPGVFBGPZJLJD-FOCLMDBBSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2/C=C/C3=CC=CC4=CC=CC=C43

Computed by PubChem (NCBI)