CAS 1233-36-9 is the registry number for (E)-1,2-Di-(1-naphtyl)ethene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
1-[(E)-2-naphthalen-1-ylethenyl]naphthalene (CAS 1233-36-9) is a chemical compound with the molecular formula C22H16 and a molecular weight of 280.4 g/mol. IUPAC name: 1-[(E)-2-naphthalen-1-ylethenyl]naphthalene. InChIKey: REPGVFBGPZJLJD-FOCLMDBBSA-N.
| Molecular formula | C22H16 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 1-[(E)-2-naphthalen-1-ylethenyl]naphthalene |
| InChIKey | REPGVFBGPZJLJD-FOCLMDBBSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2/C=C/C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)