cas: 621-12-5 — see every product listed under this CAS number, including other names
1,4-Diphenylsemicarbazide (CAS 621-12-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114DP5-1g |
| cas | 621-12-5 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 25g | 1134.80 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 25g | 1851.45 Pln |
| delivery time | 3 weeks |
|---|
1-anilino-3-phenylurea (CAS 621-12-5) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 1-anilino-3-phenylurea. InChIKey: NGZZNUMYERKSQA-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-anilino-3-phenylurea |
| InChIKey | NGZZNUMYERKSQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NNC2=CC=CC=C2 |
Computed by PubChem (NCBI)